PRODUCT Properties
| Melting point: | 38 °C |
| Boiling point: | 77-78°C/4mm |
| Density | 1.508±0.06 g/cm3(Predicted) |
| solubility | Chloroform: soluble,Methanol: soluble |
| pka | pK1:4.18 (25°C) |
| form | low melting solid |
| Major Application | clinical testing coatings environmental food and beverages |
| InChIKey | ISFKSWMQWIRDNC-UHFFFAOYSA-N |
| SMILES | FC(F)(F)C(F)(F)C(F)(F)CCC(=O)O || O=C(O)CCC(F)(F)C(F)(F)C(F)(F)F |
| CAS DataBase Reference | 356-02-5(CAS DataBase Reference) |
| EPA Substance Registry System | 3:3 Fluorotelomer carboxylic acid (356-02-5) |
Description and Uses
3-Perfluoropropyl Propanoic Acid is a standard for environmental testing and research. Studies on biodegradation of polyfluoroalkyl phosphates as source of perfluorinated acids to environment.
Safety
| Symbol(GHS) | ![]() GHS05 |
| Signal word | Danger |
| Hazard statements | H314 |
| Precautionary statements | P260-P264-P280-P301+P330+P331-P303+P361+P353-P304+P340-P305+P351+P338-P310-P321-P363-P405-P501 |
| Hazard Codes | C |
| Risk Statements | 34 |
| Safety Statements | 26-36/37/39 |
| RIDADR | 3261 |
| WGK Germany | WGK 3 |
| HazardClass | CORROSIVE |
| HS Code | 2915907098 |
| Storage Class | 8A - Combustible corrosive hazardous materials |
| Hazard Classifications | Eye Dam. 1 Skin Corr. 1B |






