![2-Amino-1H-benzo[de]isoquinoline-1,3(2H)-dione](https://img.chemicalbook.com/CAS/GIF/5690-46-0.gif)
PRODUCT Properties
| Melting point: | 265 °C |
| Boiling point: | 463.0±28.0 °C(Predicted) |
| Density | 1.470±0.06 g/cm3(Predicted) |
| storage temp. | Keep in dark place,Inert atmosphere,Room temperature |
| pka | -1.97±0.20(Predicted) |
| InChI | InChI=1S/C12H8N2O2/c13-14-11(15)8-5-1-3-7-4-2-6-9(10(7)8)12(14)16/h1-6H,13H2 |
| InChIKey | HXJBFRDWVHNPAS-UHFFFAOYSA-N |
| SMILES | C1(=O)C2=C3C(C=CC=C3C(=O)N1N)=CC=C2 |
Description and Uses
2-Amino-benzo[de]isoquinoline-1,3-dione is an antiviral compound that exhibits antiherpetic activity against herpes simplex viruses HSV-1 and HSV-2.
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H302-H315-H319-H332-H335 |
| Precautionary statements | P261-P280-P305+P351+P338 |
| Hazard Note | Harmful |
| HS Code | 2933998090 |
