BD3249545
2-Chloro-4-fluorobenzenesulfonylchloride , 97% , 85958-57-2
| Pack Size | Price | Stock | Quantity |
| 250mg | RMB32.00 | In Stock |
|
| 1g | RMB70.40 | In Stock |
|
| 5g | RMB145.60 | In Stock |
|
| 25g | RMB541.60 | In Stock |
|
| 100g | RMB2128.80 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 27-31 °C |
| Boiling point: | 243-244 °C (lit.) |
| Density | 1.569 g/mL at 25 °C (lit.) |
| refractive index | n |
| Flash point: | >230 °F |
| storage temp. | Inert atmosphere,Room Temperature |
| form | liquid |
| color | Clear, faint to light yellow |
| Sensitive | Moisture Sensitive |
| BRN | 5520034 |
| InChI | InChI=1S/C6H3Cl2FO2S/c7-5-3-4(9)1-2-6(5)12(8,10)11/h1-3H |
| InChIKey | FCFPJKHVCHKCMP-UHFFFAOYSA-N |
| SMILES | C1(S(Cl)(=O)=O)=CC=C(F)C=C1Cl |
| CAS DataBase Reference | 85958-57-2(CAS DataBase Reference) |
Safety
| Symbol(GHS) | ![]() GHS05 |
| Signal word | Danger |
| Hazard statements | H314 |
| Precautionary statements | P280-P303+P361+P353-P304+P340+P310-P305+P351+P338-P363-P405 |
| PPE | Faceshields, Gloves, Goggles, type ABEK (EN14387) respirator filter |
| Hazard Codes | C |
| Risk Statements | 34 |
| Safety Statements | 26-36/37/39-45 |
| RIDADR | UN 3265 8/PG 3 |
| WGK Germany | 3 |
| Hazard Note | Corrosive |
| HazardClass | 8 |
| PackingGroup | II |
| HS Code | 29049090 |
| Storage Class | 8A - Combustible corrosive hazardous materials |
| Hazard Classifications | Skin Corr. 1B |
| Limited Quantities | 5.0 L (1.3 gallons) (liquid) or 5.0 kg (11 lbs) (solid) |
| Excepted Quantities | Max Inner Pack (30g or 30ml) and Max Outer Pack (1Kg or 1L) |







