BD3288445
3,3',5,5'-Tetraisopropylbiphenyl-4,4'-diol , 97% , 2416-95-7
| Pack Size | Price | Stock | Quantity |
| 100mg | RMB200.80 | In Stock |
|
| 250mg | RMB280.80 | In Stock |
|
| 1g | RMB708.80 | In Stock |
|
| 5g | RMB2136.00 | In Stock |
|
| 10g | RMB3531.20 | In Stock |
|
| 25g | RMB6651.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 107.0 to 111.0 °C |
| Boiling point: | 451.9±45.0 °C(Predicted) |
| Density | 1.007±0.06 g/cm3(Predicted) |
| storage temp. | Inert atmosphere,Room Temperature |
| solubility | Chloroform (Slightly), Methanol (Slightly) |
| form | Solid |
| pka | 10.54±0.40(Predicted) |
| color | Light Yellow to Yellow |
| Major Application | pharmaceutical (small molecule) |
| InChI | InChI=1S/C24H34O2/c1-13(2)19-9-17(10-20(14(3)4)23(19)25)18-11-21(15(5)6)24(26)22(12-18)16(7)8/h9-16,25-26H,1-8H3 |
| InChIKey | QAISRHCMPQROAX-UHFFFAOYSA-N |
| SMILES | C1(C2=CC(C(C)C)=C(O)C(C(C)C)=C2)=CC(C(C)C)=C(O)C(C(C)C)=C1 |
Description and Uses
Dipropofol is a dimeric derivative of Propofol (P829750). Dipropofol is an antibacterial agent with strong activity againts Gram-positive bacteria. Dipropofol also displays antioxidant and radical sca venging activity.
Safety
| Symbol(GHS) | ![]() ![]() GHS07,GHS09 |
| Signal word | Warning |
| Hazard statements | H335-H312-H410-H302-H319-H315 |
| Precautionary statements | P280-P302+P352-P312-P322-P363-P501-P273-P391-P501-P264-P280-P302+P352-P321-P332+P313-P362-P264-P280-P305+P351+P338-P337+P313P-P264-P270-P301+P312-P330-P501 |
| WGK Germany | WGK 3 |
| HS Code | 2907299000 |
| Storage Class | 11 - Combustible Solids |







![4-Isopropyl-2,2-dimethylbenzo[d][1,3]dioxole](https://img.chemicalbook.com/CAS/GIF/201166-22-5.gif)
