BD3314948
Piretanide , 98+% , 55837-27-9
Synonym(s):
4-Phenoxy-3-(1-pyrrolidinyl)-5-sulfamoylbenzoic acid;Piretanide
CAS NO.:55837-27-9
Empirical Formula: C17H18N2O5S
Molecular Weight: 362.4
MDL number: MFCD00867334
EINECS: 259-852-9
| Pack Size | Price | Stock | Quantity |
| 1g | RMB36897.60 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 225-227° |
| Boiling point: | 253°C (rough estimate) |
| Density | 1.3049 (rough estimate) |
| refractive index | 1.6510 (estimate) |
| storage temp. | 2-8°C |
| solubility | Very slightly soluble in water, sparingly soluble in anhydrous ethanol. It shows polymorphism (5.9). |
| form | Solid |
| pka | 10.22±0.60(Predicted) |
| color | Pale-yellow platelets from MeOH (aq) |
| Major Application | pharmaceutical (small molecule) |
| InChI | 1S/C17H18N2O5S/c18-25(22,23)15-11-12(17(20)21)10-14(19-8-4-5-9-19)16(15)24-13-6-2-1-3-7-13/h1-3,6-7,10-11H,4-5,8-9H2,(H,20,21)(H2,18,22,23) |
| InChIKey | UJEWTUDSLQGTOA-UHFFFAOYSA-N |
| SMILES | [S](=O)(=O)(N)c1c(c(cc(c1)C(=O)O)N3CCCC3)Oc2ccccc2 |
| CAS DataBase Reference | 55837-27-9(CAS DataBase Reference) |
Description and Uses
High-ceiling loop diuretic; structurally related to Bumetanide (B689550). Diuretic.





