BD3350751
Bromopentacarbonylmanganese(I) , 98% , 14516-54-2
Synonym(s):
Bromopentacarbonylmanganese(I);Manganese pentacarbonyl bromide
CAS NO.:14516-54-2
Empirical Formula: C5BrMnO5
Molecular Weight: 274.89
MDL number: MFCD00049806
EINECS: 238-522-8
| Pack Size | Price | Stock | Quantity |
| 250mg | RMB508.00 | In Stock |
|
| 1g | RMB1686.40 | In Stock |
|
| 5g | RMB5059.20 | In Stock |
|
| 25g | RMB15177.60 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| storage temp. | 2-8°C |
| solubility | Soluble in organic solvents. |
| form | crystal |
| color | yellow to orange |
| Sensitive | Moisture Sensitive |
| Exposure limits | ACGIH: TWA 0.02 mg/m3; TWA 0.1 mg/m3 OSHA: Ceiling 5 mg/m3 NIOSH: IDLH 500 mg/m3; TWA 1 mg/m3; STEL 3 mg/m3 |
| InChI | InChI=1S/5CO.BrH.Mn/c5*1-2;;/h;;;;;1H;/q;;;;;;+1/p-1 |
| InChIKey | OESORJHGSXJTKX-UHFFFAOYSA-M |
| SMILES | [Mn+]([Br-])(C#O)(C#O)(C#O)(C#O)C#O |
Description and Uses
Bromopentacarbonylmanganese(I) is used in the formation of (eta6-arene)tricarbonylmanganese(I) by reacting with arene (arene= hexamethyl benzene, 1,2,4,5-tetramethyl benzene, mesitylene, p-xylene and toluene) in the presence silver salt.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H302+H312+H332 |
| Precautionary statements | P261-P264-P280-P301+P312-P302+P352+P312-P304+P340+P312 |
| Hazard Codes | Xn |
| Risk Statements | 20/21/22 |
| Safety Statements | 36 |
| RIDADR | UN3466 |
| WGK Germany | 3 |
| HazardClass | 6.1 |
| PackingGroup | II |






