BD3378253
(S)-tert-Butyl2-methyl-4-oxopiperidine-1-carboxylate , 98+% , 790667-49-1
| Pack Size | Price | Stock | Quantity |
| 250mg | RMB134.40 | In Stock |
|
| 1g | RMB234.40 | In Stock |
|
| 5g | RMB906.40 | In Stock |
|
| 25g | RMB3388.80 | In Stock |
|
| 100g | RMB7600.00 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Boiling point: | 298.8±33.0 °C(Predicted) |
| Density | 1.060±0.06 g/cm3(Predicted) |
| storage temp. | 2-8°C |
| pka | -1.52±0.40(Predicted) |
| Appearance | White to light yellow Solid |
| optical activity | 17.3°(C=1g/100mI, CHCL3,20°C,589nm) |
| InChI | InChI=1S/C11H19NO3/c1-8-7-9(13)5-6-12(8)10(14)15-11(2,3)4/h8H,5-7H2,1-4H3/t8-/m0/s1 |
| InChIKey | HQMYWQCBINPHBB-QMMMGPOBSA-N |
| SMILES | N1(C(OC(C)(C)C)=O)CCC(=O)C[C@@H]1C |
Description and Uses
(2S)-2-Methyl-4-oxo-piperidine-1-carboxylic acid tert-butyl ester is also known as tert-butyl (2S)-2-methyl-4-oxopiperidine-1-carboxylate. It is used as a pharmaceutical intermediate in pharmaceutical synthesis and scientific research.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H302-H315-H319-H335 |
| Precautionary statements | P261-P305+P351+P338 |



![tert-Butyl 6-oxo-2-azaspiro[3.3]heptane-2-carboxylate](https://img.chemicalbook.com/CAS/20180808/GIF/1181816-12-5.gif)

![tert-butyl 2,7-diazaspiro[3.5]nonane-2-carboxylate](https://img.chemicalbook.com/CAS/GIF/236406-55-6.gif)

