BD8308131
tert-Butyl 6-oxo-2-azaspiro[3.3]heptane-2-carboxylate , 98% , 1181816-12-5
| Pack Size | Price | Stock | Quantity |
| 100mg | RMB24.00 | In Stock |
|
| 250mg | RMB32.00 | In Stock |
|
| 1g | RMB85.60 | In Stock |
|
| 5g | RMB236.00 | In Stock |
|
| 10g | RMB456.80 | In Stock |
|
| 25g | RMB1100.80 | In Stock |
|
| 100g | RMB4068.80 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 114.5-116 °C |
| Boiling point: | 314.7±42.0 °C(Predicted) |
| Density | 1.16±0.1 g/cm3(Predicted) |
| storage temp. | 2-8°C |
| pka | -0.93±0.20(Predicted) |
| form | solid |
| color | Pale yellow |
| InChI | InChI=1S/C11H17NO3/c1-10(2,3)15-9(14)12-6-11(7-12)4-8(13)5-11/h4-7H2,1-3H3 |
| InChIKey | HQHRAGXKFOTSQE-UHFFFAOYSA-N |
| SMILES | C1C2(CC(=O)C2)CN1C(OC(C)(C)C)=O |
| CAS DataBase Reference | 1181816-12-5 |
Description and Uses
tert-Butyl 6-oxo-2-azaspiro[3.3]heptane-2-carboxylate is a reagent used for the preparation of γ-butyrolactone derivative via Baeyer-Villiger monooxygenase (BVMO)-catalyzed oxidation.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H319-H335-H302+H312+H332-H315 |
| Precautionary statements | P280-P301+P312-P304+P340 |
| HS Code | 2933998090 |

![tert-Butyl 6-oxo-2-azaspiro[3.3]heptane-2-carboxylate](https://img.chemicalbook.com/CAS/20180808/GIF/1181816-12-5.gif)


![tert-butyl 2,7-diazaspiro[3.5]nonane-2-carboxylate](https://img.chemicalbook.com/CAS/GIF/236406-55-6.gif)


![tert-Butyl2-azaspiro[3.3]heptan-6-ylcarbamate](https://img.chemicalbook.com/CAS2/GIF/1118786-85-8.gif)