BD4929841
tert-Butyl2-azaspiro[3.3]heptan-6-ylcarbamate , 97% , 1118786-85-8
CAS NO.:1118786-85-8
Empirical Formula: C11H20N2O2
Molecular Weight: 212.29
MDL number: MFCD11858159
| Pack Size | Price | Stock | Quantity |
| 100mg | RMB558.40 | In Stock |
|
| 250mg | RMB837.60 | In Stock |
|
| 1g | RMB2513.60 | In Stock |
|
| 5g | RMB8119.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Boiling point: | 329.0±42.0 °C(Predicted) |
| Density | 1.09 |
| storage temp. | 2-8°C(protect from light) |
| pka | 12.38±0.20(Predicted) |
| Appearance | White to off-white Solid |
| InChI | InChI=1S/C11H20N2O2/c1-10(2,3)15-9(14)13-8-4-11(5-8)6-12-7-11/h8,12H,4-7H2,1-3H3,(H,13,14) |
| InChIKey | CBYPCXLWNJUVLF-UHFFFAOYSA-N |
| SMILES | C(OC(C)(C)C)(=O)NC1CC2(CNC2)C1 |
Description and Uses
Tert-Butyl 2-azaspiro[3.3]heptan-6-ylcarbamate is an important pharmaceutical intermediate and organic synthesis building block, mainly used in the field of medicinal chemistry to synthesize bioactive molecules containing spirocyclic structures. Its unique spiro[3.3]heptane skeleton can provide novel three-dimensional spatial configurations.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H302-H315-H319-H335 |
| Precautionary statements | P261-P305+P351+P338 |
| HS Code | 2933998090 |

![tert-Butyl2-azaspiro[3.3]heptan-6-ylcarbamate](https://img.chemicalbook.com/CAS2/GIF/1118786-85-8.gif)

![tert-Butyl(6-oxospiro[3.3]heptan-2-yl)carbamate](https://img.chemicalbook.com/CAS/GIF/1118786-86-9.gif)
![tert-Butyl 6-oxo-2-azaspiro[3.3]heptane-2-carboxylate](https://img.chemicalbook.com/CAS/20180808/GIF/1181816-12-5.gif)

![tert-butyl 2,7-diazaspiro[3.5]nonane-2-carboxylate](https://img.chemicalbook.com/CAS/GIF/236406-55-6.gif)
