BD3391251
(2S,4S)-Pentane-2,4-diylbis(diphenylphosphine) , 98% , 77876-39-2
Synonym(s):
(S,S)-BDPP;[(1S,3S)-1,3-Dimethyl-1,3-propanediyl]bis[diphenylphosphine]
| Pack Size | Price | Stock | Quantity |
| 100mg | RMB158.40 | In Stock |
|
| 250mg | RMB288.00 | In Stock |
|
| 1g | RMB862.40 | In Stock |
|
| 5g | RMB3502.40 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 81°C |
| Boiling point: | 543.8±33.0 °C(Predicted) |
| alpha | -124° (c 3.0, CHCl3) |
| storage temp. | under inert gas (nitrogen or Argon) at 2-8°C |
| solubility | Benzene (Slightly), Chloroform (Sparingly), Methanol (Slightly) |
| form | crystal |
| color | white |
| optical activity | [α]20/D 125.0°, c = 1 in chloroform |
| Sensitive | air sensitive |
| InChI | 1S/C29H30P2/c1-24(30(26-15-7-3-8-16-26)27-17-9-4-10-18-27)23-25(2)31(28-19-11-5-12-20-28)29-21-13-6-14-22-29/h3-22,24-25H,23H2,1-2H3/t24-,25-/m0/s1 |
| InChIKey | CTYPJIUQROQJBG-DQEYMECFSA-N |
| SMILES | C[C@@H](C[C@H](C)P(c1ccccc1)c2ccccc2)P(c3ccccc3)c4ccccc4 |
| CAS DataBase Reference | 77876-39-2(CAS DataBase Reference) |
Description and Uses
Ligand used for asymmetric hydrogenation of ketones and alkenes
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H413-H315-H319-H335 |
| Precautionary statements | P261-P280a-P304+P340-P305+P351+P338-P405-P501a |
| PPE | Eyeshields, Gloves, type N95 (US) |
| Risk Statements | 36/37/38 |
| Safety Statements | 24/25 |
| WGK Germany | 3 |
| TSCA | No |
| HS Code | 29310099 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Aquatic Chronic 4 |






