BD3404145
3-Pyridyloxyaceticacid , 98% , 86649-57-2
| Pack Size | Price | Stock | Quantity |
| 100mg | RMB152.00 | In Stock |
|
| 250mg | RMB266.40 | In Stock |
|
| 1g | RMB640.80 | In Stock |
|
| 5g | RMB1631.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 210-212°C |
| Boiling point: | 312.9±17.0 °C(Predicted) |
| Density | 1.300±0.06 g/cm3(Predicted) |
| storage temp. | Inert atmosphere,Room Temperature |
| pka | 2.56±0.10(Predicted) |
| Appearance | White to yellow Solid |
| Water Solubility | Slightly Soluble in water (2.0 g/L) |
| InChI | InChI=1S/C7H7NO3/c9-7(10)5-11-6-2-1-3-8-4-6/h1-4H,5H2,(H,9,10) |
| InChIKey | MBEPWLCDXKKANL-UHFFFAOYSA-N |
| SMILES | C(O)(=O)COC1=CC=CN=C1 |
| LogP | 0.280 (est) |
Description and Uses
3-Pyridyloxyacetic acid is used in synthesis of raw material for fine chemicals, organic intermediate, pharmaceutical intermediate.
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P280a-P304+P340-P305+P351+P338-P405-P501a |
| Hazard Codes | Xi,Xn |
| Risk Statements | 20/21/22-36/37/38-22 |
| Safety Statements | 26-36/37/39 |
| HazardClass | IRRITANT |
| HS Code | 2933399990 |
