BD3482545
Di(adamantan-1-yl)(benzyl)phosphine , 98% , 395116-70-8
Synonym(s):
cataCXium ABn
CAS NO.:395116-70-8
Empirical Formula: C27H37P
Molecular Weight: 392.56
MDL number: MFCD05861603
EINECS: 1312995-182-4
| Pack Size | Price | Stock | Quantity |
| 250mg | RMB84.00 | In Stock |
|
| 1g | RMB205.60 | In Stock |
|
| 5g | RMB699.20 | In Stock |
|
| 25g | RMB2620.00 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 183°C |
| storage temp. | Inert atmosphere,Store in freezer, under -20°C |
| form | Powder |
| color | yellow |
| Sensitive | air sensitive |
| BRN | 9359745 |
| InChI | InChI=1S/C27H37P/c1-2-4-19(5-3-1)18-28(26-12-20-6-21(13-26)8-22(7-20)14-26)27-15-23-9-24(16-27)11-25(10-23)17-27/h1-5,20-25H,6-18H2 |
| InChIKey | ANIAFEJRWQDKDV-UHFFFAOYSA-N |
| SMILES | P(CC1=CC=CC=C1)(C12CC3CC(CC(C3)C1)C2)C12CC3CC(CC(C3)C1)C2 |
Description and Uses
Catalyst for:
- Sonogashira coupling reaction
- Ruthenium-catalyzed amination of secondary alcohols. with ammonia
- Rhodium-catalyzed regioselective hydroformylation of alkenes
- Reductive carbonylation
- Suzuki coupling reaction
Safety
| Symbol(GHS) | ![]() GHS05 |
| Signal word | Danger |
| Hazard statements | H314 |
| Precautionary statements | P501-P264-P280-P303+P361+P353-P301+P330+P331-P363-P304+P340+P310-P305+P351+P338+P310-P405 |
| PPE | Eyeshields, Gloves, type N95 (US) |
| Safety Statements | 24/25 |
| WGK Germany | 3 |
| HS Code | 29319090 |
| Storage Class | 11 - Combustible Solids |






