BD3527845
3,5-Bis(trifluoromethyl)-1,2-diaminobenzene , 97% , 367-65-7
CAS NO.:367-65-7
Empirical Formula: C8H6F6N2
Molecular Weight: 244.14
MDL number: MFCD01631430
EINECS: 670-794-7
| Pack Size | Price | Stock | Quantity |
| 250mg | RMB47.20 | In Stock |
|
| 1g | RMB113.60 | In Stock |
|
| 5g | RMB475.20 | In Stock |
|
| 10g | RMB855.20 | In Stock |
|
| 25g | RMB2052.00 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 42-44°C |
| Boiling point: | 228.2±40.0 °C(Predicted) |
| Density | 1.516±0.06 g/cm3(Predicted) |
| storage temp. | Keep in dark place,Sealed in dry,Room Temperature |
| form | solid |
| pka | 1.72±0.10(Predicted) |
| Appearance | Light brown to brown Solid |
| Water Solubility | Insoluble in water. |
| BRN | 3344332 |
| InChI | 1S/C8H6F6N2/c9-7(10,11)3-1-4(8(12,13)14)6(16)5(15)2-3/h1-2H,15-16H2 |
| InChIKey | BRLIJPMFMGTIAW-UHFFFAOYSA-N |
| SMILES | FC(F)(F)c1c(c(cc(c1)C(F)(F)F)N)N |
| CAS DataBase Reference | 367-65-7(CAS DataBase Reference) |
Description and Uses
It is applied as an active pharmaceutical intermediate.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H302-H319 |
| Precautionary statements | P305+P351+P338 |
| Hazard Codes | T |
| Risk Statements | 20/21/22-36/37/38-36 |
| Safety Statements | 26-36/37/39 |
| RIDADR | 2811 |
| WGK Germany | WGK 3 |
| Hazard Note | Toxic |
| HazardClass | 6.1 |
| PackingGroup | III |
| HS Code | 2921599090 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Acute Tox. 4 Oral Eye Irrit. 2 |






