BD3618848
Fmoc-Arg(Pmc)-OH , 98+% , 119831-72-0
Synonym(s):
Fmoc-Arg(Pmc)-OH;N-α-Fmoc-N G-(2,2,5,7,8-pentamethylchroman-6-sulfonyl)-L-arginine
| Pack Size | Price | Stock | Quantity |
| 5g | RMB396.00 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 70-120°C(decomposition) |
| Density | 1.35±0.1 g/cm3(Predicted) |
| storage temp. | Sealed in dry,2-8°C |
| pka | 3.83±0.21(Predicted) |
| form | Powder |
| color | White |
| Major Application | peptide synthesis |
| InChIKey | QTWZCODKTSUZJN-LJAQVGFWSA-N |
| SMILES | [S](=O)(=O)(\N=C(\NCCC[C@H](NC(=O)OCC3c4c(cccc4)c5c3cccc5)C(=O)O)/N)c1c(c2c(c(c1C)C)OC(CC2)(C)C)C |
Description and Uses
Fmoc-Arg(Pmc)-OH (CAS# 119831-72-0) is an fmoc-protected form of L-Argenine used in the synthesis of peptides and peptide fragments, such as in the synthetic preparation of TGR5 agonists.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H335-H319-H315 |
| Precautionary statements | P264-P280-P305+P351+P338-P337+P313P-P264-P280-P302+P352-P321-P332+P313-P362 |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-36 |
| WGK Germany | 3 |
| F | 21 |
| HS Code | 2935 90 90 |
| Storage Class | 11 - Combustible Solids |





