BD3643345
(R)-2-Benzhydrylpyrrolidine , 98%99%ee , 22348-31-8
| Pack Size | Price | Stock | Quantity |
| 250mg | RMB67.20 | In Stock |
|
| 1g | RMB254.40 | In Stock |
|
| 5g | RMB1112.00 | In Stock |
|
| 10g | RMB1901.60 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Boiling point: | 349.6±11.0 °C(Predicted) |
| Density | 1.062 g/mL at 25 °C (lit.) |
| refractive index | n |
| Flash point: | >230 °F |
| storage temp. | 2-8°C |
| pka | 10.68±0.10(Predicted) |
| Appearance | White to off-white Solid |
| optical activity | [α]20/D +3.0°, c = 1% in chloroform |
| InChI | InChI=1S/C17H19N/c1-3-8-14(9-4-1)17(16-12-7-13-18-16)15-10-5-2-6-11-15/h1-6,8-11,16-18H,7,12-13H2/t16-/m1/s1 |
| InChIKey | OXOBKZZXZVFOBB-MRXNPFEDSA-N |
| SMILES | N1CCC[C@@H]1C(C1=CC=CC=C1)C1=CC=CC=C1 |
Description and Uses
Used as excellent chiral solvating agents to determine the enantiomeric composition of chiral carboxylic acids directly by NMR analysis.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H302-H315-H319-H335 |
| Precautionary statements | P261-P264-P270-P301+P312-P302+P352-P305+P351+P338 |
| target organs | Respiratory system |
| PPE | Eyeshields, Faceshields, Gloves, type ABEK (EN14387) respirator filter |
| Hazard Codes | Xn |
| Risk Statements | 22-36/37/38 |
| Safety Statements | 26-36 |
| WGK Germany | 3 |
| HS Code | 29339900 |
| Storage Class | 10 - Combustible liquids |
| Hazard Classifications | Acute Tox. 4 Oral Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |



![2,6-Bis[[(R)-2-[hydroxy(diphenyl)methyl]-1-pyrrolidinyl]methyl]-4-methylphenol](https://img.chemicalbook.com/StructureFile/ChemBookStructure9/GIF/CB6257675.gif)


