BD3882446
Ethyl2,4-Dimethyl-5-(ethoxycarbonyl)-3-pyrrolepropionate , 97% , 54278-10-3
| Pack Size | Price | Stock | Quantity |
| 250mg | RMB108.80 | In Stock |
|
| 1g | RMB211.20 | In Stock |
|
| 5g | RMB986.40 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 75-77 °C(lit.) |
| Boiling point: | 165-170 °C(Press: 0.02 Torr) |
| Density | 1.111±0.06 g/cm3(Predicted) |
| storage temp. | Sealed in dry,Room Temperature |
| pka | 16.40±0.50(Predicted) |
| form | chunks |
| Appearance | White to off-white Solid |
| InChI | 1S/C14H21NO4/c1-5-18-12(16)8-7-11-9(3)13(15-10(11)4)14(17)19-6-2/h15H,5-8H2,1-4H3 |
| InChIKey | ZYNJVGCLOFPWFZ-UHFFFAOYSA-N |
| SMILES | CCOC(=O)CCc1c(C)[nH]c(C(=O)OCC)c1C |
| CAS DataBase Reference | 54278-10-3(CAS DataBase Reference) |
Description and Uses
Ethyl 2,4-dimethyl-5-(ethoxycarbonyl)-3-pyrrolepropionate may be used in chemical synthesis studies.
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P264-P271-P280-P302+P352-P305+P351+P338 |
| target organs | Respiratory system |
| PPE | dust mask type N95 (US), Eyeshields, Gloves |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-37/39 |
| WGK Germany | 3 |
| HazardClass | IRRITANT |
| HS Code | 2933998090 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |
