BD3883146
2,4,5-Trichlorobenzene-1-sulfonylchloride , 98% , 15945-07-0
CAS NO.：15945-07-0
Empirical Formula: C6H2Cl4O2S
Molecular Weight: 279.96
MDL number: MFCD00007428
EINECS: 240-079-0
| Pack Size | Price | Stock | Quantity |
| 1g | RMB44.00 | In Stock |
|
| 5g | RMB64.80 | In Stock |
|
| 10g | RMB89.60 | In Stock |
|
| 25g | RMB198.40 | In Stock |
|
| 100g | RMB653.60 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 65-69 °C |
| Boiling point: | 138 °C(Press: 0.5 Torr) |
| Density | 1.728±0.06 g/cm3(Predicted) |
| storage temp. | Inert atmosphere,2-8°C |
| solubility | soluble in Toluene |
| form | powder to crystal |
| color | White to Almost white |
| Sensitive | Moisture Sensitive |
| BRN | 1112595 |
| InChI | 1S/C6H2Cl4O2S/c7-3-1-5(9)6(2-4(3)8)13(10,11)12/h1-2H |
| InChIKey | WNVVRCKTQSCPAC-UHFFFAOYSA-N |
| SMILES | Clc1cc(Cl)c(cc1Cl)S(Cl)(=O)=O |
| CAS DataBase Reference | 15945-07-0(CAS DataBase Reference) |
| EPA Substance Registry System | Benzenesulfonyl chloride, 2,4,5-trichloro- (15945-07-0) |
Description and Uses
2,4,5-Trichloro-benzenesulfonyl chloride is a useful building block for organic synthesis.
Safety
| Symbol(GHS) |  GHS05 |
| Signal word | Danger |
| Hazard statements | H314 |
| Precautionary statements | P260-P280-P303+P361+P353-P304+P340+P310-P305+P351+P338-P363 |
| PPE | Eyeshields, Faceshields, Gloves, type P3 (EN 143) respirator cartridges |
| Hazard Codes | C |
| Risk Statements | 34-14 |
| Safety Statements | 26-27-36/37/39-8-45 |
| RIDADR | 3261 |
| WGK Germany | 3 |
| Hazard Note | Corrosive/Moisture Sensitive |
| TSCA | TSCA listed |
| HazardClass | 8 |
| PackingGroup | II |
| HS Code | 29049095 |
| Storage Class | 8A - Combustible corrosive hazardous materials |
| Hazard Classifications | Skin Corr. 1B |
| Limited Quantities | 1.0 L (0.3 gallons) (liquid) or 1 Kg (2.2 lbs) (solid) |
| Excepted Quantities | Max Inner Pack (30g or 30ml) and Max Outer Pack (500g or 500ml) |
