BD0360145
2,5-DichlorobenzenesulfonylChloride , 97% , 5402-73-3
CAS NO.:5402-73-3
Empirical Formula: C6H3Cl3O2S
Molecular Weight: 245.51
MDL number: MFCD00007429
EINECS: 226-453-6
| Pack Size | Price | Stock | Quantity |
| 5g | RMB68.80 | In Stock |
|
| 10g | RMB132.00 | In Stock |
|
| 25g | RMB327.20 | In Stock |
|
| 100g | RMB921.60 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 36-37 °C(lit.) |
| Boiling point: | 253°C (estimate) |
| Density | 1.608 (estimate) |
| Flash point: | >230 °F |
| storage temp. | Inert atmosphere,Room Temperature |
| solubility | Chloroform, DMSO |
| form | solid |
| color | Off-White to Pale Beige |
| Sensitive | Moisture Sensitive |
| BRN | 2369410 |
| InChI | 1S/C6H3Cl3O2S/c7-4-1-2-5(8)6(3-4)12(9,10)11/h1-3H |
| InChIKey | BXCOSWRSIISQSL-UHFFFAOYSA-N |
| SMILES | Clc1ccc(Cl)c(c1)S(Cl)(=O)=O |
| CAS DataBase Reference | 5402-73-3(CAS DataBase Reference) |
| EPA Substance Registry System | Benzenesulfonyl chloride, 2,5-dichloro- (5402-73-3) |
Description and Uses
2,5-Dichlorobenzenesulfonyl chloride was used to study the synthesis and structure–activity profile of benzoxazole benzenesulfonamide analogs.
Safety
| Symbol(GHS) | ![]() ![]() GHS05,GHS07 |
| Signal word | Danger |
| Hazard statements | H314-H335 |
| Precautionary statements | P260-P271-P280-P303+P361+P353-P304+P340+P310-P305+P351+P338 |
| target organs | Respiratory system |
| PPE | Eyeshields, Faceshields, Gloves, type P3 (EN 143) respirator cartridges |
| Hazard Codes | C |
| Risk Statements | 34-36/37 |
| Safety Statements | 26-27-28-36/37/39-45 |
| RIDADR | UN 3261 8/PG 2 |
| WGK Germany | 3 |
| Hazard Note | Corrosive |
| TSCA | TSCA listed |
| HazardClass | 8 |
| PackingGroup | II |
| HS Code | 29049090 |
| Storage Class | 8A - Combustible corrosive hazardous materials |
| Hazard Classifications | Eye Dam. 1 Skin Corr. 1B STOT SE 3 |
| Limited Quantities | 5.0 L (1.3 gallons) (liquid) or 5.0 kg (11 lbs) (solid) |
| Excepted Quantities | Max Inner Pack (30g or 30ml) and Max Outer Pack (1Kg or 1L) |







