BD3919546
Methyl2-amino-3-(4-hydroxyphenyl)-2-methylpropanoatehydrochloride , 95% , 7361-31-1
Synonym(s):
α-MT methyl ester hydrochloride;2-Methyl-4-hydroxy-DL -phenylalanine methyl ester hydrochloride;AMPT methyl ester hydrochloride
CAS NO.：7361-31-1
Empirical Formula: C11H16ClNO3
Molecular Weight: 245.7
MDL number: MFCD00012606
EINECS: 230-900-0
| Pack Size | Price | Stock | Quantity |
| 100mg | RMB373.60 | In Stock |
|
| 250mg | RMB564.80 | In Stock |
|
| 1g | RMB1412.00 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 192 °C (dec.)(lit.) |
| storage temp. | -20°C |
| solubility | H2O: 50 mg/mL, clear, faintly yellow |
| form | Solid |
| color | White to light yellow |
| BRN | 5163031 |
| InChI | 1S/C11H15NO3.ClH/c1-11(12,10(14)15-2)7-8-3-5-9(13)6-4-8;/h3-6,13H,7,12H2,1-2H3;1H |
| InChIKey | OOVDEPZODSXAMU-UHFFFAOYSA-N |
| SMILES | Cl[H].COC(=O)C(C)(N)Cc1ccc(O)cc1 |
| CAS DataBase Reference | 7361-31-1(CAS DataBase Reference) |
| EPA Substance Registry System | Methyl .alpha.-methyltyrosinate hydrochloride (7361-31-1) |
Description and Uses
α-Methyl-DL-tyrosine methyl ester hydrochloride has been used to evaluate norepinephrine turnover.
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H302-H315-H319-H335 |
| Precautionary statements | P261-P305+P351+P338 |
| PPE | Eyeshields, Gloves, type N95 (US) |
| Safety Statements | 22-24/25 |
| WGK Germany | 3 |
| RTECS | YP2900000 |
| F | 10 |
| TSCA | TSCA listed |
| Storage Class | 11 - Combustible Solids |
