BD3950746
2-Benzyloxybenzoicacid , 98% , 14389-86-7
Synonym(s):
Salicylic acid benzyl ether
| Pack Size | Price | Stock | Quantity |
| 1g | RMB24.00 | In Stock |
|
| 5g | RMB96.00 | In Stock |
|
| 10g | RMB184.00 | In Stock |
|
| 25g | RMB350.40 | In Stock |
|
| 100g | RMB1376.80 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 73-77 °C |
| Boiling point: | 397.6±17.0 °C(Predicted) |
| Density | 1.222±0.06 g/cm3(Predicted) |
| storage temp. | Inert atmosphere,Room Temperature |
| solubility | soluble in Methanol |
| form | powder to crystal |
| pka | 3.44±0.36(Predicted) |
| color | White to Light yellow |
| InChI | InChI=1S/C14H12O3/c15-14(16)12-8-4-5-9-13(12)17-10-11-6-2-1-3-7-11/h1-9H,10H2,(H,15,16) |
| InChIKey | GMOYUTKNPLBTMT-UHFFFAOYSA-N |
| SMILES | C(O)(=O)C1=CC=CC=C1OCC1=CC=CC=C1 |
| CAS DataBase Reference | 14389-86-7(CAS DataBase Reference) |
| EPA Substance Registry System | 2-Benzyloxybenzoic acid (14389-86-7) |
Description and Uses
2-Benzyloxybenzoic Acid has been used as a reactant in the synthesis of mycobactin S2
Safety
| Symbol(GHS) | ![]() ![]() GHS07,GHS09 |
| Signal word | Warning |
| Hazard statements | H302-H315-H319-H335-H400 |
| Precautionary statements | P273-P301+P312+P330-P302+P352-P305+P351+P338 |
| target organs | Respiratory system |
| PPE | dust mask type N95 (US), Eyeshields, Gloves |
| Hazard Codes | Xn,N |
| Risk Statements | 22-36/37/38-50/53 |
| Safety Statements | 22-24/25-61-60-36/37-26 |
| RIDADR | UN 3077 9/PG 3 |
| WGK Germany | 3 |
| HazardClass | IRRITANT |
| PackingGroup | III |
| HS Code | 2916399090 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Acute Tox. 4 Oral Aquatic Acute 1 Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |
| Limited Quantities | 5.0 L (1.3 gallons) (liquid) or 5.0 kg (11 lbs) (solid) |
| Excepted Quantities | Max Inner Pack (30g or 30ml) and Max Outer Pack (1Kg or 1L) |







