BD3961648
(Z)-But-2-ene-1,4-diyldiacetate , 98% , 25260-60-0
Synonym(s):
cis-2-Butene-1,4-diol diacetate
CAS NO.:25260-60-0
Empirical Formula: C8H12O4
Molecular Weight: 172.18
MDL number: MFCD00059339
EINECS: 607-674-0
| Pack Size | Price | Stock | Quantity |
| 1g | RMB83.20 | In Stock |
|
| 5g | RMB272.00 | In Stock |
|
| 25g | RMB501.60 | In Stock |
|
| 100g | RMB1972.00 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Boiling point: | 120-121 °C/18 mmHg (lit.) |
| Density | 1.08 g/mL at 25 °C (lit.) |
| vapor pressure | 0.24-13.1Pa at 20-50℃ |
| refractive index | 1.4416 |
| Flash point: | >110°C |
| storage temp. | 2-8°C |
| form | Liquid |
| color | Clear colorless |
| Water Solubility | Not miscible in water. |
| BRN | 1724379 |
| InChI | 1S/C8H12O4/c1-7(9)11-5-3-4-6-12-8(2)10/h3-4H,5-6H2,1-2H3/b4-3- |
| InChIKey | VZUAUHWZIKOMFC-ARJAWSKDSA-N |
| SMILES | [H]\C(COC(C)=O)=C(/[H])COC(C)=O |
| LogP | -0.1-1.1 at 25℃ and pH3.3 |
| CAS DataBase Reference | 25260-60-0(CAS DataBase Reference) |
Description and Uses
cis-1,4-Diacetoxy-2-butene is used as an organic chemical synthesis intermediate.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315 |
| Precautionary statements | P264-P280-P302+P352-P332+P313-P362+P364 |
| PPE | Eyeshields, Gloves, type ABEK (EN14387) respirator filter |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-36/37/39-36 |
| WGK Germany | 3 |
| HS Code | 29161995 |
| Storage Class | 10 - Combustible liquids |
| Hazard Classifications | Skin Irrit. 2 |





