BD1173948
(1R,3S)-rel-Cyclopent-4-ene-1,3-diyldiacetate , 98% , 54664-61-8
Synonym(s):
cis-4-Cyclopentene-1,3-diol diacetate
| Pack Size | Price | Stock | Quantity |
| 100mg | RMB75.20 | In Stock |
|
| 250mg | RMB125.60 | In Stock |
|
| 1g | RMB375.20 | In Stock |
|
| 5g | RMB1265.60 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Boiling point: | 81-82 °C(Press: 5 Torr) |
| Density | 1.127 g/mL at 20 °C(lit.) |
| refractive index | n |
| storage temp. | 2-8°C |
| form | solid |
| Specific Gravity | 1.127 |
| Appearance | Colorless to light yellow Liquid |
| BRN | 1961566 |
| InChI | 1S/C9H12O4/c1-6(10)12-8-3-4-9(5-8)13-7(2)11/h3-4,8-9H,5H2,1-2H3/t8-,9+ |
| InChIKey | UKPIBFMHHUEUQR-DTORHVGOSA-N |
| SMILES | CC(=O)O[C@@H]1C[C@H](OC(C)=O)C=C1 |
Description and Uses
cis-3,5-Diacetoxy-1-cyclopentene may be employed as substrate to investigate the enantioselectivity of esterase EstA3 (obtained from a drinking water metagenome) and esterase EstCE1 (obtained from a soil metagenome).
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H302-H315-H319-H332-H335 |
| Precautionary statements | P261-P280-P305+P351+P338 |
| PPE | Eyeshields, Gloves |
| Safety Statements | 23-24/25 |
| WGK Germany | 3 |
| RTECS | WE1650000 |
| HS Code | 2902190000 |
| Storage Class | 10 - Combustible liquids |
