BD0610453
cis-Cyclopent-4-ene-1,3-diol , 98% , 29783-26-4
Synonym(s):
cis-3,5-Dihydroxy-1-cyclopentene
| Pack Size | Price | Stock | Quantity |
| 100mg | RMB463.20 | In Stock |
|
| 250mg | RMB692.00 | In Stock |
|
| 1g | RMB1721.60 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 55-59 °C |
| Boiling point: | 110-111 °C(Press: 6 Torr) |
| Density | 1.182 g/cm3(Temp: 15.5 °C) |
| storage temp. | Store at room temperature |
| pka | 14.01±0.40(Predicted) |
| form | solid |
| Appearance | Off-white to yellow Solid |
| optical activity | 1.0° (C=1.01 g/100ml, MEOH) |
| BRN | 2039395 |
| InChI | InChI=1/C5H8O2/c6-4-1-2-5(7)3-4/h1-2,4-7H,3H2/t4-,5+ |
| InChIKey | IGRLIBJHDBWKNA-SYDPRGILNA-N |
| SMILES | [C@H]1(O)C=C[C@@H](O)C1 |&1:0,4,r| |
Description and Uses
cis-4-Cyclopentene-1,3-diol is an important building block for the synthesis of natural products with cyclopentanoid structure elements. It was used in preparation of key intermediates of prostaglandin synthesis.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P302+P352-P305+P351+P338 |
| target organs | Respiratory system |
| PPE | dust mask type N95 (US), Eyeshields, Gloves |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26 |
| WGK Germany | 3 |
| F | 3-10 |
| HS Code | 2906190090 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |




