PRODUCT Properties
| Melting point: | 49-51 °C |
| Boiling point: | 207.984±40.00 °C(Press: 760.00 Torr)(predicted) |
| Density | 1.171±0.10 g/cm3(Temp: 25 °C; Press: 760 Torr)(predicted) |
| storage temp. | Store at +2°C to +8°C. |
| pka | 14.109±0.40(predicted) |
| optical activity | [α]20/D -67±2°, c =2.3% in chloroform |
| InChI | 1S/C7H10O3/c1-5(8)10-7-3-2-6(9)4-7/h2-3,6-7,9H,4H2,1H3/t6-,7+/m0/s1 |
| InChIKey | IJDYOKVVRXZCFD-NKWVEPMBSA-N |
| SMILES | CC(=O)O[C@H]1C[C@@H](O)C=C1 |
Description and Uses
(1R,4S)-cis-4-Acetoxy-2-cyclopenten-1-ol can be used as a reactant in the total synthesis of Bartlett′s brefeldin intermediate, spinosyn A analogs, (+)-7-deaza-5′-noraristeromycin, (±) strychnine and the Wieland-Gumlich aldehyde.





