BD4649341
2-Chloro-4-(trifluoromethyl)benzene-1-sulfonylchloride , 95% , 175205-54-6
CAS NO.:175205-54-6
Empirical Formula: C7H3Cl2F3O2S
Molecular Weight: 279.06
MDL number: MFCD00052912
| Pack Size | Price | Stock | Quantity |
| 250mg | RMB35.20 | In Stock |
|
| 1g | RMB83.20 | In Stock |
|
| 5g | RMB268.00 | In Stock |
|
| 10g | RMB423.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 37-39°C |
| Boiling point: | 70-71 °C/0.5 mmHg (lit.) |
| Density | 1.597 g/mL at 25 °C (lit.) |
| refractive index | n |
| Flash point: | >230 °F |
| storage temp. | under inert gas (nitrogen or Argon) at 2-8°C |
| form | clear liquid |
| color | Light orange to Yellow to Green |
| Sensitive | Moisture Sensitive |
| InChI | 1S/C7H3Cl2F3O2S/c8-5-3-4(7(10,11)12)1-2-6(5)15(9,13)14/h1-3H |
| InChIKey | NJXDBSSSDPOAFI-UHFFFAOYSA-N |
| SMILES | FC(F)(F)c1ccc(c(Cl)c1)S(Cl)(=O)=O |
| CAS DataBase Reference | 175205-54-6(CAS DataBase Reference) |
Safety
| Symbol(GHS) | ![]() ![]() GHS05,GHS07 |
| Signal word | Danger |
| Hazard statements | H318-H314-H317-H290 |
| Precautionary statements | P280-P305+P351+P338-P310-P234-P260-P264-P301+P330+P331+P310-P303+P361+P353+P310+P363-P304+P340+P310-P305+P351+P338+P310-P390-P405-P406-P501-P309 |
| PPE | Faceshields, Gloves, Goggles, type ABEK (EN14387) respirator filter |
| Hazard Codes | C |
| Risk Statements | 34-43 |
| Safety Statements | 26-36/37/39-45 |
| RIDADR | UN 3265 8/PG 3 |
| WGK Germany | 3 |
| Hazard Note | Corrosive |
| HazardClass | 8 |
| PackingGroup | II |
| HS Code | 29049090 |
| Storage Class | 8A - Combustible corrosive hazardous materials |
| Hazard Classifications | Eye Dam. 1 Skin Corr. 1B Skin Sens. 1 |
| Limited Quantities | 1.0 L (0.3 gallons) (liquid) or 1 Kg (2.2 lbs) (solid) |
| Excepted Quantities | Max Inner Pack (30g or 30ml) and Max Outer Pack (500g or 500ml) |







