BD4752141
Methyl4-amino-5-chloro-2-methoxybenzoate , 96% , 20896-27-9
| Pack Size | Price | Stock | Quantity |
| 250mg | RMB234.40 | In Stock |
|
| 1g | RMB582.40 | In Stock |
|
| 5g | RMB2322.40 | In Stock |
|
| 250g | RMB16000.00 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 135-137 °C |
| Boiling point: | 372.3±37.0 °C(Predicted) |
| Density | 1.302±0.06 g/cm3(Predicted) |
| storage temp. | Keep in dark place,Sealed in dry,Room Temperature |
| solubility | DMSO (Slightly), Methanol (Slightly) |
| form | solid |
| pka | 0.10±0.10(Predicted) |
| color | Brown |
| InChI | InChI=1S/C9H10ClNO3/c1-13-8-4-7(11)6(10)3-5(8)9(12)14-2/h3-4H,11H2,1-2H3 |
| InChIKey | ALYQFGBPEGLBLW-UHFFFAOYSA-N |
| SMILES | C(OC)(=O)C1=CC(Cl)=C(N)C=C1OC |
| CAS DataBase Reference | 20896-27-9 |
Description and Uses
Methyl 4-Amino-5-chloro-2-methoxybenzoate is used in preparation of phenoxymethylpyridine derivatives as immunomodulators.
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H302-H315-H319-H335 |
| Precautionary statements | P280-P301+P312-P305+P351+P338 |
| HS Code | 2920907090 |
