![7,10-Dichloro-2-methoxybenzo[b]-1,5-naphthyridine](https://img.chemicalbook.com/CAS/GIF/6626-40-0.gif)
BD5136441
7,10-Dichloro-2-methoxybenzo[b]-1,5-naphthyridine , 95% , 6626-40-0
CAS NO.：6626-40-0
Empirical Formula: C13H8Cl2N2O
Molecular Weight: 279.12
MDL number: MFCD00160720
EINECS: 229-588-9
| Pack Size | Price | Stock | Quantity |
| 250mg | RMB89.60 | In Stock |
|
| 1g | RMB224.00 | In Stock |
|
| 5g | RMB712.00 | In Stock |
|
| 25g | RMB2520.00 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 186-187 °C |
| Boiling point: | 434.0±40.0 °C(Predicted) |
| Density | 1.453±0.06 g/cm3(Predicted) |
| storage temp. | under inert gas (nitrogen or Argon) at 2-8°C |
| solubility | Chloroform (Sparingly), DMSO (Slightly, Heated), Methanol (Slightly, Heated) |
| form | Solid |
| pka | 0.49±0.40(Predicted) |
| color | Pale Yellow |
| InChI | InChI=1S/C13H8Cl2N2O/c1-18-11-5-4-9-13(17-11)12(15)8-3-2-7(14)6-10(8)16-9/h2-6H,1H3 |
| InChIKey | KHPZCNJKNIHKPI-UHFFFAOYSA-N |
| SMILES | N1=C2C(N=C(OC)C=C2)=C(Cl)C2=CC=C(Cl)C=C12 |
Description and Uses
7,10-Dichloro-2-methoxybenzo[b][1,5]naphthyridine is used in the preparation of pyronaridine.
Safety
| Symbol(GHS) |   GHS05,GHS06 |
| Signal word | Danger |
| Hazard statements | H413-H315-H301-H318-H335 |
| Precautionary statements | P264-P280-P302+P352-P321-P332+P313-P362-P264-P270-P301+P310-P321-P330-P405-P501-P280-P305+P351+P338-P310 |
