BD5157941
2-(4-(tert-Butyl)phenyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane , 98% , 214360-66-4
| Pack Size | Price | Stock | Quantity |
| 1g | RMB24.00 | In Stock |
|
| 5g | RMB97.60 | In Stock |
|
| 10g | RMB182.40 | In Stock |
|
| 25g | RMB425.60 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 139.9-140.9 °C |
| Boiling point: | 333.6±21.0 °C(Predicted) |
| Density | 0.96±0.1 g/cm3(Predicted) |
| storage temp. | under inert gas (nitrogen or Argon) at 2-8°C |
| form | solid |
| Appearance | White to off-white Solid |
| InChI | 1S/C16H25BO2/c1-14(2,3)12-8-10-13(11-9-12)17-18-15(4,5)16(6,7)19-17/h8-11H,1-7H3 |
| InChIKey | SAWJXFQIAPLBEA-UHFFFAOYSA-N |
| SMILES | B2(OC(C(O2)(C)C)(C)C)c1ccc(cc1)C(C)(C)C |
Description and Uses
4-t-Butylphenylboronic acid, pinacol ester
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H302-H315-H319-H335 |
| Precautionary statements | P261-P305+P351+P338 |
| WGK Germany | 3 |
| HS Code | 2931900090 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Aquatic Chronic 4 |
