BD5168041
6-Methoxyquinoline1-oxide , 97% , 6563-13-9
| Pack Size | Price | Stock | Quantity |
| 250mg | RMB96.00 | In Stock |
|
| 1g | RMB240.00 | In Stock |
|
| 5g | RMB660.00 | In Stock |
|
| 10g | RMB1018.40 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 102-104 °C (lit.) |
| Boiling point: | 340.1±34.0 °C(Predicted) |
| Density | 1.16±0.1 g/cm3(Predicted) |
| storage temp. | Sealed in dry,Room Temperature |
| form | powder to crystal |
| pka | 0.66±0.30(Predicted) |
| color | White to Yellow to Orange |
| λmax | 320nm(EtOH)(lit.) |
| InChI | 1S/C10H9NO2/c1-13-9-4-5-10-8(7-9)3-2-6-11(10)12/h2-7H,1H3 |
| InChIKey | BWEGRKPOJXNZSK-UHFFFAOYSA-N |
| SMILES | COc1ccc2[n+]([O-])cccc2c1 |
Description and Uses
The standard molar enthalpy of formation of 6-methoxyquinoline N-oxide was studied using static-bomb calorimetry.
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P264-P271-P280-P302+P352-P305+P351+P338 |
| target organs | Respiratory system |
| PPE | dust mask type N95 (US), Eyeshields, Gloves |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-36 |
| WGK Germany | 3 |
| HS Code | 2933998090 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |
