F770822
Quinoline N-oxide hydrate , 97 , 64201-64-5
CAS NO.:64201-64-5
Empirical Formula: C9H9NO2
Molecular Weight: 163.17
MDL number: MFCD00149472
EINECS: 216-560-6
| Pack Size | Price | Stock | Quantity |
| 5g | RMB1085.60 | In Stock |
|
| 25g | RMB3493.60 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 52-55 °C(lit.) |
| Flash point: | >230 °F |
| Sensitive | Hygroscopic |
| BRN | 5989589 |
| InChI | 1S/C9H7NO.H2O/c11-10-7-3-5-8-4-1-2-6-9(8)10;/h1-7H;1H2 |
| InChIKey | CUSWDTBBCIXCRB-UHFFFAOYSA-N |
| SMILES | [H]O[H].[O-][n+]1cccc2ccccc12 |
| CAS DataBase Reference | 64201-64-5(CAS DataBase Reference) |
Description and Uses
Quinoline N-oxide hydrate is used in quantitative determination of nitrones using trifluoroacetic anhydride-sodium iodide reagent.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P280-P261 |
| PPE | Eyeshields, Gloves, type N95 (US) |
| Hazard Codes | Xi |
| Risk Statements | 36/38 |
| Safety Statements | 22-24/25-37/39-26 |
| WGK Germany | 3 |
| RTECS | VC2340000 |
| F | 3-10 |
| HS Code | 2933499090 |
| Storage Class | 11 - Combustible Solids |






