BD7020947
H-DL-Ala-OEt.HCl , 95% , 617-27-6
CAS NO.:617-27-6
Empirical Formula: C5H12ClNO2
Molecular Weight: 153.61
MDL number: MFCD00013018
EINECS: 210-507-0
| Pack Size | Price | Stock | Quantity |
| 25g | RMB56.80 | In Stock |
|
| 100g | RMB191.20 | In Stock |
|
| 500g | RMB706.40 | In Stock |
|
| 1000g | RMB1049.60 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 85-87 °C(lit.) |
| storage temp. | Inert atmosphere,2-8°C |
| solubility | Methanol (Sparingly), Water |
| form | Granular Powder and Granules |
| color | White |
| Sensitive | Hygroscopic |
| BRN | 3654425 |
| Major Application | peptide synthesis |
| InChI | InChI=1S/C5H11NO2.ClH/c1-3-8-5(7)4(2)6;/h4H,3,6H2,1-2H3;1H |
| InChIKey | JCXLZWMDXJFOOI-UHFFFAOYSA-N |
| SMILES | C(=O)(C(N)C)OCC.Cl |
| CAS DataBase Reference | 617-27-6(CAS DataBase Reference) |
| EPA Substance Registry System | Alanine, ethyl ester, hydrochloride (617-27-6) |
Description and Uses
Alanine derivative
Safety
| Symbol(GHS) | ![]() ![]() GHS08,GHS02 |
| Signal word | Danger |
| Hazard statements | H304-H226 |
| Precautionary statements | P501-P240-P210-P233-P243-P241-P242-P280-P370+P378-P331-P303+P361+P353-P301+P310-P403+P235-P405 |
| PPE | Eyeshields, Gloves, type N95 (US) |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 22-24/25 |
| WGK Germany | 3 |
| TSCA | TSCA listed |
| HS Code | 29224999 |
| Storage Class | 11 - Combustible Solids |







