BD7587131
5,6-Dimethoxyindole , 98% , 14430-23-0
CAS NO.：14430-23-0
Empirical Formula: C10H11NO2
Molecular Weight: 177.2
MDL number: MFCD00005675
EINECS: 238-402-5
| Pack Size | Price | Stock | Quantity |
| 100mg | RMB87.20 | In Stock |
|
| 250mg | RMB112.00 | In Stock |
|
| 1g | RMB226.40 | In Stock |
|
| 5g | RMB972.80 | In Stock |
|
| 10g | RMB1790.40 | In Stock |
|
| 25g | RMB4291.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 154-157 °C (lit.) |
| Boiling point: | 198°C 8mm |
| Density | 1.182±0.06 g/cm3(Predicted) |
| Flash point: | 198°C/8mm |
| storage temp. | Sealed in dry,Room Temperature |
| pka | 16.93±0.30(Predicted) |
| form | Powder |
| color | Beige |
| Water Solubility | Insoluble in water. |
| λmax | 306nm(EtOH)(lit.) |
| BRN | 5683 |
| InChI | InChI=1S/C10H11NO2/c1-12-9-5-7-3-4-11-8(7)6-10(9)13-2/h3-6,11H,1-2H3 |
| InChIKey | QODBZRNBPUPLEZ-UHFFFAOYSA-N |
| SMILES | N1C2=C(C=C(OC)C(OC)=C2)C=C1 |
| CAS DataBase Reference | 14430-23-0(CAS DataBase Reference) |
Description and Uses
5,6-Dimethoxyindole is an indole derivative as analgesic antiinflammatory. It was used in the synthesis of N-benzyl-N-cyclopropyl-5,6-dimethoxyindole-3-glyoxalamide.
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P271-P280 |
| Hazard Codes | Xi |
| Safety Statements | 22-24/25 |
| WGK Germany | 3 |
| F | 10 |
| HazardClass | IRRITANT |
| HS Code | 29339900 |
