BD7690931
(5-Nitro-1,3-phenylene)dimethanol , 95% , 71176-55-1
CAS NO.:71176-55-1
Empirical Formula: C8H9NO4
Molecular Weight: 183.16
MDL number: MFCD00007274
EINECS: 275-255-6
| Pack Size | Price | Stock | Quantity |
| 250mg | RMB84.00 | In Stock |
|
| 1g | RMB244.80 | In Stock |
|
| 5g | RMB992.80 | In Stock |
|
| 10g | RMB1918.40 | In Stock |
|
| 25g | RMB4140.00 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 94-96 °C (lit.) |
| Boiling point: | 421.9±35.0 °C(Predicted) |
| Density | 1.420 |
| storage temp. | Sealed in dry,Room Temperature |
| form | solid |
| pka | 13.45±0.10(Predicted) |
| Appearance | Off-white to light yellow Solid |
| InChI | InChI=1S/C8H9NO4/c10-4-6-1-7(5-11)3-8(2-6)9(12)13/h1-3,10-11H,4-5H2 |
| InChIKey | FTLFITNFXXERLN-UHFFFAOYSA-N |
| SMILES | C1(CO)=CC([N+]([O-])=O)=CC(CO)=C1 |
Description and Uses
5-Nitro-m-xylene-α,α′-diol was used to fabricate chemical sensor for detection of explosive 2,4,6-trinitrotoluene by planar integrated optical waveguide attenuated total reflection spectrometry.
Safety
| WGK Germany | 3 |
| Storage Class | 11 - Combustible Solids |





