BD7701231
Ethyl cyclopropanecarboxylate , 97% , 4606-07-9
CAS NO.：4606-07-9
Empirical Formula: C6H10O2
Molecular Weight: 114.14
MDL number: MFCD00001282
EINECS: 225-010-4
| Pack Size | Price | Stock | Quantity |
| 5g | RMB23.20 | In Stock |
|
| 10g | RMB28.80 | In Stock |
|
| 25g | RMB39.20 | In Stock |
|
| 100g | RMB140.80 | In Stock |
|
| 500g | RMB631.20 | In Stock |
|
| 1000g | RMB1072.00 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Boiling point: | 129-133 °C (lit.) |
| Density | 0.96 g/mL at 25 °C (lit.) |
| refractive index | n |
| Flash point: | 65 °F |
| storage temp. | Sealed in dry,2-8°C |
| solubility | Chloroform, Methanol (Slightly) |
| form | Liquid |
| color | Clear pale yellow |
| PH | 7 (H2O) |
| Water Solubility | immiscible |
| BRN | 2039752 |
| InChI | InChI=1S/C6H10O2/c1-2-8-6(7)5-3-4-5/h5H,2-4H2,1H3 |
| InChIKey | LDDOSDVZPSGLFZ-UHFFFAOYSA-N |
| SMILES | C1(C(OCC)=O)CC1 |
| CAS DataBase Reference | 4606-07-9(CAS DataBase Reference) |
| NIST Chemistry Reference | Ethyl cyclopropanecarboxylate(4606-07-9) |
Description and Uses
Ethyl cyclopropanecarboxylate is a reagent used in the addition of cyclopropane.
Safety
| Symbol(GHS) |  GHS02 |
| Signal word | Danger |
| Hazard statements | H225 |
| Precautionary statements | P210 |
| Hazard Codes | F |
| Risk Statements | 11 |
| Safety Statements | 16 |
| RIDADR | UN 3272 3/PG 2 |
| WGK Germany | 3 |
| Hazard Note | Highly Flammable |
| HazardClass | 3 |
| PackingGroup | II |
| HS Code | 29162000 |
| Limited Quantities | 1.0 L (0.3 gallon) (liquid) |
| Excepted Quantities | Max Inner Pack (30g or 30ml) and Max Outer Pack (500g or 500ml) |
