BD7831331
(S)-1-tert-Butyl 2-methyl 4,4-difluoropyrrolidine-1,2-dicarboxylate , 97% , 203866-17-5
Synonym(s):
tert-Butyl (2S)-2-(methoxycarbonyl)-4,4-difluoropyrrolidine-1-carboxylate;1-tert-Butyl 2-methyl (2S)-4,4-difluoro-1,2-pyrrolidinedicarboxylate
CAS NO.:203866-17-5
Empirical Formula: C11H17F2NO4
Molecular Weight: 265.25
MDL number: MFCD03094918
| Pack Size | Price | Stock | Quantity |
| 100mg | RMB61.60 | In Stock |
|
| 250mg | RMB81.60 | In Stock |
|
| 1g | RMB127.20 | In Stock |
|
| 5g | RMB627.20 | In Stock |
|
| 10g | RMB1005.60 | In Stock |
|
| 25g | RMB2444.00 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 41-46 °C |
| Boiling point: | 293℃ |
| Density | 1.22 |
| Flash point: | 110 °C |
| storage temp. | 2-8°C |
| form | White to off-white crystalline powder |
| pka | -8.00±0.60(Predicted) |
| Appearance | White to light yellow Solid |
| Major Application | peptide synthesis |
| InChI | InChI=1S/C11H17F2NO4/c1-10(2,3)18-9(16)14-6-11(12,13)5-7(14)8(15)17-4/h7H,5-6H2,1-4H3/t7-/m0/s1 |
| InChIKey | RQDZKOOUQIDZOG-ZETCQYMHSA-N |
| SMILES | N1(C(OC(C)(C)C)=O)CC(F)(F)C[C@H]1C(OC)=O |
Description and Uses
peptide synthesis
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H302-H315-H319-H335 |
| Precautionary statements | P261-P301+P312-P302+P352-P304+P340-P305+P351+P338 |
| PPE | Eyeshields, Gloves, type N95 (US) |
| WGK Germany | 3 |
| HS Code | 29339900 |
| Storage Class | 11 - Combustible Solids |





