BD7847231
(S)-7-Hydroxy-1,2,3,4-tetrahydroisoquinoline-3-carboxylic acid , 97% , 128502-56-7
| Pack Size | Price | Stock | Quantity |
| 250mg | RMB133.60 | In Stock |
|
| 1g | RMB306.40 | In Stock |
|
| 5g | RMB1414.40 | In Stock |
|
| 10g | RMB2481.60 | In Stock |
|
| 25g | RMB5782.40 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 273-275 °C |
| Boiling point: | 329.41°C (rough estimate) |
| Density | 1.2307 (rough estimate) |
| refractive index | 1.5300 (estimate) |
| storage temp. | Keep in dark place,Sealed in dry,2-8°C |
| pka | 2.19±0.20(Predicted) |
| Appearance | Off-white to light brown Solid |
| InChI | InChI=1S/C10H11NO3/c12-8-2-1-6-4-9(10(13)14)11-5-7(6)3-8/h1-3,9,11-12H,4-5H2,(H,13,14)/t9-/m0/s1 |
| InChIKey | HIKCRLDSCSWXML-VIFPVBQESA-N |
| SMILES | C1C2=C(C=CC(O)=C2)C[C@@H](C(O)=O)N1 |
| CAS DataBase Reference | 128502-56-7(CAS DataBase Reference) |
Description and Uses
L-7-Hydroxy-1,2,3,4-tetrahydroisoquinoline-3-carboxylic Acid is a possible histone deacetylases (HDACs) inhibitor. It is used in the design of boronic acid-based autotaxin inhibitors.
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H302-H315-H335-H319 |
| Precautionary statements | P264-P270-P301+P312-P330-P501-P264-P280-P302+P352-P321-P332+P313-P362-P264-P280-P305+P351+P338-P337+P313P |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 24/25-26 |
| HS Code | 29334990 |
