BD7887531
Boc-Hyp-OL , 97% , 61478-26-0
| Pack Size | Price | Stock | Quantity |
| 250mg | RMB24.00 | In Stock |
|
| 1g | RMB28.80 | In Stock |
|
| 5g | RMB104.80 | In Stock |
|
| 10g | RMB202.40 | In Stock |
|
| 25g | RMB492.00 | In Stock |
|
| 100g | RMB1933.60 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 81-86 °C (lit.) |
| alpha | -47o (C=1 IN CHLOROFORM) |
| Boiling point: | 340.3±27.0 °C(Predicted) |
| Density | 1.190±0.06 g/cm3(Predicted) |
| storage temp. | under inert gas (nitrogen or Argon) at 2-8°C |
| solubility | Chloroform (Slightly), Methanol (Slightly) |
| form | Solid |
| pka | 14.57±0.40(Predicted) |
| color | White |
| optical activity | [α]20/D 47°, c = 1 in chloroform |
| Sensitive | Air Sensitive |
| Major Application | peptide synthesis |
| InChI | InChI=1S/C10H19NO4/c1-10(2,3)15-9(14)11-5-8(13)4-7(11)6-12/h7-8,12-13H,4-6H2,1-3H3/t7-,8+/m0/s1 |
| InChIKey | UFJNFQNQLMGUTQ-JGVFFNPUSA-N |
| SMILES | N1(C(OC(C)(C)C)=O)C[C@H](O)C[C@H]1CO |
| CAS DataBase Reference | 61478-26-0(CAS DataBase Reference) |
Description and Uses
BOC-HYP-OL is a useful reactant used in the preparation of 4-purinylpyrrolidine nucleosides, kinase inhibitors and antibacterial agents.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P280a-P304+P340-P305+P351+P338-P405-P501a |
| PPE | Eyeshields, Gloves, type N95 (US) |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-37 |
| WGK Germany | 3 |
| HazardClass | IRRITANT |
| HS Code | 29339900 |
| Storage Class | 11 - Combustible Solids |






