BD7894931
Diethyl 2-acetylsuccinate , 97% , 1115-30-6
CAS NO.:1115-30-6
Empirical Formula: C10H16O5
Molecular Weight: 216.23
MDL number: MFCD00009157
EINECS: 214-223-8
| Pack Size | Price | Stock | Quantity |
| 1g | RMB24.00 | In Stock |
|
| 5g | RMB81.60 | In Stock |
|
| 10g | RMB154.40 | In Stock |
|
| 25g | RMB314.40 | In Stock |
|
| 100g | RMB1189.60 | In Stock |
|
| 500g | RMB4843.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | -8 °C |
| Boiling point: | 180-183 °C/50 mmHg (lit.) |
| Density | 1.081 g/mL at 25 °C (lit.) |
| vapor pressure | 2.8Pa at 25℃ |
| refractive index | n |
| Flash point: | >230 °F |
| storage temp. | Sealed in dry,Room Temperature |
| form | Liquid |
| pka | 10.63±0.59(Predicted) |
| color | Clear slightly yellow |
| Water Solubility | 15g/L at 20℃ |
| InChI | 1S/C10H16O5/c1-4-14-9(12)6-8(7(3)11)10(13)15-5-2/h8H,4-6H2,1-3H3 |
| InChIKey | DVSDDICSXBCMQJ-UHFFFAOYSA-N |
| SMILES | CCOC(=O)CC(C(C)=O)C(=O)OCC |
| LogP | 0.25 |
| CAS DataBase Reference | 1115-30-6(CAS DataBase Reference) |
| EPA Substance Registry System | Butanedioic acid, acetyl-, diethyl ester (1115-30-6) |
Description and Uses
Diethyl 2-Acetylsuccinate functions as a reagent in the synthesis of Coumarin and Coumarin-3-acetic acid derivatives that exhibites antimicrobial activities against variety of gram positive and gram negative bacteria.
Safety
| PPE | Eyeshields, Gloves |
| Safety Statements | 24/25 |
| WGK Germany | 3 |
| TSCA | TSCA listed |
| HazardClass | IRRITANT |
| HS Code | 29183000 |
| Storage Class | 10 - Combustible liquids |



