BD7928231
Ethyl 2,4-Dichloro-5-pyrimidinecarboxylate , 97% , 51940-64-8
CAS NO.：51940-64-8
Empirical Formula: C7H6Cl2N2O2
Molecular Weight: 221.04
MDL number: MFCD09910281
EINECS: 257-531-8
| Pack Size | Price | Stock | Quantity |
| 1g | RMB24.00 | In Stock |
|
| 5g | RMB84.80 | In Stock |
|
| 10g | RMB154.40 | In Stock |
|
| 25g | RMB356.80 | In Stock |
|
| 100g | RMB1354.40 | In Stock |
|
| 500g | RMB5551.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 36-37℃ |
| Boiling point: | 145°C/11mmHg(lit.) |
| Density | 1.433 |
| storage temp. | Inert atmosphere,2-8°C |
| solubility | Chloroform (Slightly), Methanol (Slightly) |
| form | Powder |
| pka | -4.47±0.29(Predicted) |
| color | White |
| Water Solubility | Slightly soluble in water. |
| Stability: | Hygroscopic |
| InChI | InChI=1S/C7H6Cl2N2O2/c1-2-13-6(12)4-3-10-7(9)11-5(4)8/h3H,2H2,1H3 |
| InChIKey | SRJBDGLSCPDXBL-UHFFFAOYSA-N |
| SMILES | C1(Cl)=NC=C(C(OCC)=O)C(Cl)=N1 |
Description and Uses
It's employed as an important intermediate for raw material for organic synthesis, agrochemical, pharmaceutical and dyestuff field
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H335-H315-H319 |
| Precautionary statements | P264-P280-P302+P352+P332+P313+P362+P364-P305+P351+P338+P337+P313-P261-P280a-P304+P340-P305+P351+P338-P405-P501a |
| HS Code | 2933599590 |
