BD7946631
2-Methyl-1-naphthol , 97% , 7469-77-4
CAS NO.:7469-77-4
Empirical Formula: C11H10O
Molecular Weight: 158.2
MDL number: MFCD00003964
EINECS: 231-265-2
| Pack Size | Price | Stock | Quantity |
| 100mg | RMB98.40 | In Stock |
|
| 250mg | RMB140.80 | In Stock |
|
| 1g | RMB396.80 | In Stock |
|
| 5g | RMB1508.80 | In Stock |
|
| 10g | RMB2591.20 | In Stock |
|
| 25g | RMB5168.00 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 64-66 °C (lit.) |
| Boiling point: | 304.3±11.0 °C(Predicted) |
| Density | 1.144±0.06 g/cm3(Predicted) |
| storage temp. | -20°C |
| pka | 9.94±0.50(Predicted) |
| form | solid |
| Appearance | Off-white to light yellow Solid |
| Cosmetics Ingredients Functions | HAIR DYEING |
| InChI | InChI=1S/C11H10O/c1-8-6-7-9-4-2-3-5-10(9)11(8)12/h2-7,12H,1H3 |
| InChIKey | SRJCJJKWVSSELL-UHFFFAOYSA-N |
| SMILES | C1(O)=C2C(C=CC=C2)=CC=C1C |
| LogP | 3.170 (est) |
Description and Uses
2-Methyl-1-naphthol was used in selective synthesis of vitamin K3 via liquid-phase oxidation using NbSBA-15 catalyst.
Safety
| Symbol(GHS) | ![]() ![]() GHS05,GHS07 |
| Signal word | Danger |
| Hazard statements | H315-H318-H335 |
| Precautionary statements | P261-P280-P305+P351+P338 |
| Hazard Codes | Xi |
| Risk Statements | 37/38-41 |
| Safety Statements | 26-39 |
| WGK Germany | 3 |
| HS Code | 2906290090 |







