BD7949531
2-Hydroxy-3a,4,7,7a-tetrahydro-1H-4,7-epoxyisoindole-1,3(2H)-dione , 95% , 5596-17-8
| Pack Size | Price | Stock | Quantity |
| 250mg | RMB128.80 | In Stock |
|
| 1g | RMB196.80 | In Stock |
|
| 5g | RMB851.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 194 °C (dec.)(lit.) |
| Boiling point: | 384.8±52.0 °C(Predicted) |
| Density | 1.728 |
| storage temp. | Inert atmosphere,Store in freezer, under -20°C |
| solubility | THF: soluble 10mg/mL, clear, colorless |
| pka | 8.60±0.20(Predicted) |
| Appearance | White to off-white Solid |
| InChI | 1S/C8H7NO4/c10-7-5-3-1-2-4(13-3)6(5)8(11)9(7)12/h1-6,12H/t3-,4+,5,6 |
| InChIKey | PPVGNPSAUJFBJY-LAXKNYFCSA-N |
| SMILES | ON1C(=O)[C@H]2C3OC(C=C3)[C@H]2C1=O |
Description and Uses
exo-N-Hydroxy-7-oxabicyclo[2.2.1]hept-5-ene-2,3-dicarboximide undergoes cross-coupling with aryl boronic acid for ROMP-based O-alkylhydroxylamine parallel synthesis.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P264-P280-P302+P352-P321-P332+P313-P362-P264-P280-P305+P351+P338-P337+P313P |
| PPE | dust mask type N95 (US), Eyeshields, Gloves |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-37/39 |
| WGK Germany | 3 |
| Storage Class | 11 - Combustible Solids |






