BD8109831
N-(5-Bromopentyl)phthalimide , 97% , 954-81-4
Synonym(s):
2-(5-Bromopentyl)isoindole-1,3-dione
CAS NO.:954-81-4
Empirical Formula: C13H14BrNO2
Molecular Weight: 296.16
MDL number: MFCD00060522
EINECS: 674-061-2
| Pack Size | Price | Stock | Quantity |
| 1g | RMB48.00 | In Stock |
|
| 5g | RMB133.60 | In Stock |
|
| 10g | RMB228.80 | In Stock |
|
| 25g | RMB404.80 | In Stock |
|
| 100g | RMB1192.00 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 58 °C |
| Boiling point: | 393.1±25.0 °C(Predicted) |
| Density | 1.459±0.06 g/cm3 (20 ºC 760 Torr) |
| storage temp. | Sealed in dry,Room Temperature |
| form | powder to crystal |
| pka | -2.13±0.20(Predicted) |
| color | White to Light yellow |
| Water Solubility | Insoluble in water. |
| λmax | 295nm(EtOH)(lit.) |
| BRN | 177015 |
| InChI | 1S/C13H14BrNO2/c14-8-4-1-5-9-15-12(16)10-6-2-3-7-11(10)13(15)17/h2-3,6-7H,1,4-5,8-9H2 |
| InChIKey | QKVHAKICMNABGB-UHFFFAOYSA-N |
| SMILES | BrCCCCCN1C(=O)c2ccccc2C1=O |
| CAS DataBase Reference | 954-81-4(CAS DataBase Reference) |
Description and Uses
It is a pharmaceutical intermediate and is used in medicine.
Safety
| Symbol(GHS) | ![]() ![]() GHS07,GHS09 |
| Signal word | Warning |
| Hazard statements | H302-H315-H317-H319-H335-H400 |
| Precautionary statements | P273-P280-P301+P312+P330-P302+P352-P305+P351+P338 |
| target organs | Respiratory system |
| Hazard Codes | Xi,N,Xn |
| Risk Statements | 36/37/38-50/53-43-22 |
| Safety Statements | 26-36/37/39-61-60-36/37 |
| RIDADR | UN 3077 9/PG 3 |
| WGK Germany | 3 |
| HazardClass | IRRITANT |
| HS Code | 2933998090 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Acute Tox. 4 Oral Aquatic Acute 1 Eye Irrit. 2 Skin Irrit. 2 Skin Sens. 1 STOT SE 3 |






