BD8175431
3,4,5,6-Tetrachlorobenzene-1,2-diol , 95% , 1198-55-6
| Pack Size | Price | Stock | Quantity |
| 100mg | RMB36.00 | In Stock |
|
| 250mg | RMB87.20 | In Stock |
|
| 1g | RMB251.20 | In Stock |
|
| 5g | RMB948.00 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 193-195 °C (lit.) |
| Boiling point: | 352.31°C (rough estimate) |
| Density | 1.8232 (rough estimate) |
| refractive index | 1.4813 (estimate) |
| storage temp. | Keep in dark place,Sealed in dry,Room Temperature |
| solubility | Dichloromethane |
| pka | 5.68±0.33(Predicted) |
| form | Solid |
| color | Off-White |
| InChI | InChI=1S/C6H2Cl4O2/c7-1-2(8)4(10)6(12)5(11)3(1)9/h11-12H |
| InChIKey | RRBMVWQICIXSEO-UHFFFAOYSA-N |
| SMILES | C1(O)=C(Cl)C(Cl)=C(Cl)C(Cl)=C1O |
| CAS DataBase Reference | 1198-55-6(CAS DataBase Reference) |
| EPA Substance Registry System | Tetrachlorocatechol (1198-55-6) |
Description and Uses
Tetrachlorocatechol is an intermediate in the synthesis of Heptachlorodibenzo-p-dioxin which is a toxic polychlorinated dibenzo-p-dioxin detected in domestic meat and poultry.
Safety
| Symbol(GHS) |    GHS05,GHS07,GHS09 |
| Signal word | Danger |
| Hazard statements | H302-H318-H400 |
| Precautionary statements | P273-P280-P305+P351+P338 |
| Hazard Codes | Xn |
| Risk Statements | 20/22-41-22 |
| Safety Statements | 26-36/37/39-39 |
| RIDADR | 2811 |
| WGK Germany | 3 |
| RTECS | UX2449000 |
| HS Code | 2908.19.6000 |
| HazardClass | 6.1(b) |
| PackingGroup | III |
