BD8191831
Boc-Phe(3-Br)-OH , 98% , 82278-73-7
CAS NO.：82278-73-7
Empirical Formula: C14H18BrNO4
Molecular Weight: 344.2
MDL number: MFCD01317710
EINECS: 1592732-453-0
| Pack Size | Price | Stock | Quantity |
| 250mg | RMB43.20 | In Stock |
|
| 1g | RMB96.80 | In Stock |
|
| 5g | RMB360.80 | In Stock |
|
| 10g | RMB679.20 | In Stock |
|
| 25g | RMB1364.00 | In Stock |
|
| 100g | RMB4228.80 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 106.1°C |
| Boiling point: | 475.3±40.0 °C(Predicted) |
| Density | 1.5311 (rough estimate) |
| refractive index | 1.6500 (estimate) |
| storage temp. | Sealed in dry,Room Temperature |
| pka | 3.81±0.10(Predicted) |
| form | Solid |
| color | White to off-white |
| optical activity | Consistent with structure |
| Water Solubility | Slightly soluble in water. |
| InChI | InChI=1S/C14H18BrNO4/c1-14(2,3)20-13(19)16-11(12(17)18)8-9-5-4-6-10(15)7-9/h4-7,11H,8H2,1-3H3,(H,16,19)(H,17,18)/t11-/m0/s1 |
| InChIKey | FBUDYESOPLBQIR-NSHDSACASA-N |
| SMILES | C(O)(=O)[C@H](CC1=CC=CC(Br)=C1)NC(OC(C)(C)C)=O |
| CAS DataBase Reference | 82278-73-7(CAS DataBase Reference) |
Description and Uses
N-Boc-3-bromo-L-phenylalanine is used as pharmaceutical intermediate.
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P264-P280-P302+P352-P321-P332+P313-P362-P305+P351+P338-P337+P313-P261-P271-P304+P340-P312-P403+P233-P405-P501 |
| HazardClass | IRRITANT |
| HS Code | 2922498590 |
