BD8231331
4-Amino-6-chloropyrimidine-5-carbonitrile , 97% , 60025-09-4
| Pack Size | Price | Stock | Quantity |
| 250mg | RMB32.80 | In Stock |
|
| 1g | RMB80.00 | In Stock |
|
| 5g | RMB242.40 | In Stock |
|
| 10g | RMB446.40 | In Stock |
|
| 25g | RMB1071.20 | In Stock |
|
| 100g | RMB3590.40 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 200℃ (DEC.) |
| Boiling point: | 402.4±45.0 °C(Predicted) |
| Density | 1.53 |
| storage temp. | under inert gas (nitrogen or Argon) at 2–8 °C |
| pka | -0.58±0.10(Predicted) |
| Appearance | White to yellow Solid |
| InChI | InChI=1S/C5H3ClN4/c6-4-3(1-7)5(8)10-2-9-4/h2H,(H2,8,9,10) |
| InChIKey | MAVMFCKRFRCMLE-UHFFFAOYSA-N |
| SMILES | C1=NC(Cl)=C(C#N)C(N)=N1 |
Description and Uses
4-Amino-6-chloropyrimidine-5-carbonitrile is a useful research reagent for organic synthesis and other chemical processes.
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H302-H315-H319-H332-H335 |
| Precautionary statements | P261-P280-P305+P351+P338 |
| HS Code | 2933599590 |
