BD8240931
tert-Butyl 2,4-dioxopiperidine-1-carboxylate , 97% , 845267-78-9
Synonym(s):
tert-Butyl 2,4-dioxopiperidine-1-carboxylate
CAS NO.:845267-78-9
Empirical Formula: C10H15NO4
Molecular Weight: 213.23
MDL number: MFCD10566071
EINECS: 825-755-0
| Pack Size | Price | Stock | Quantity |
| 1g | RMB24.00 | In Stock |
|
| 5g | RMB68.00 | In Stock |
|
| 10g | RMB132.00 | In Stock |
|
| 25g | RMB320.80 | In Stock |
|
| 100g | RMB1260.80 | In Stock |
|
| 500g | RMB6055.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Boiling point: | 373.8±35.0 °C(Predicted) |
| Density | 1.199 |
| storage temp. | Keep in dark place,Sealed in dry,Room Temperature |
| pka | 10.67±0.20(Predicted) |
| form | powder |
| color | Yellow |
| InChI | InChI=1S/C10H15NO4/c1-10(2,3)15-9(14)11-5-4-7(12)6-8(11)13/h4-6H2,1-3H3 |
| InChIKey | SLCAHLSQXDNQSF-UHFFFAOYSA-N |
| SMILES | N1(C(OC(C)(C)C)=O)CCC(=O)CC1=O |
Description and Uses
tert-Butyl 2,4-Dioxocyclohexanecarboxylate is a reactant in the synthesis of phenoxymethyl-dihydrothiazolopyridone derivatives as selective positive allosteric modulators (PAMs) of the metabotropic glutamate 5 (mGlu5) receptor.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P264b-P271-P280-P302+P352-P304+P340-P305+P351+P338-P312-P362+P364-P403+P233-P501c |
| Risk Statements | 20/21/22 |
| Safety Statements | 23-24/25 |
| WGK Germany | 3 |
| HS Code | 29337900 |



![<I>cis</I>-<WBR>Bicyclo[3.3.0]<WBR>octane-<WBR>3,7-<WBR>dione](https://img.chemicalbook.com/CAS/GIF/51716-63-3.gif)



