BD8271847
Tetramethylmethylenebis(phosphonate) , 98% , 16001-93-7
| Pack Size | Price | Stock | Quantity |
| 250mg | RMB84.00 | In Stock |
|
| 1g | RMB172.00 | In Stock |
|
| 5g | RMB600.00 | In Stock |
|
| 25g | RMB2159.20 | In Stock |
|
| 100g | RMB7125.60 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Boiling point: | 152-154°C 2,5mm |
| Density | 1?+-.0.06 g/cm3(Predicted) |
| refractive index | 1.4550 |
| Flash point: | 152-154°C/2.5mm |
| storage temp. | 2-8°C |
| solubility | Chloroform (Sparingly), Methanol (Sparingly) |
| form | Oil |
| color | Colourless |
| Water Solubility | Miscible with water. |
| BRN | 1874756 |
| Stability: | Moisture Sensitive |
| InChI | InChI=1S/C5H14O6P2/c1-8-12(6,9-2)5-13(7,10-3)11-4/h5H2,1-4H3 |
| InChIKey | XAVFZUKFLWOSOS-UHFFFAOYSA-N |
| SMILES | C(P(=O)(OC)OC)P(=O)(OC)OC |
| CAS DataBase Reference | 16001-93-7 |
Description and Uses
Tetramethyl methylenediphosphonate is used in the preparation of phosphonate analogue of ribose-1-phosphate.
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H302-H315-H319 |
| Precautionary statements | P280h-P305+P351+P338 |
| Risk Statements | 22 |
| Safety Statements | 23-36/37/39 |
| RIDADR | 3278 |
| HazardClass | 6.1 |
| PackingGroup | III |
