BD8383747
4-Bromo-2,5-difluorobenzenesulfonylchloride , 98% , 207974-14-9
CAS NO.：207974-14-9
Empirical Formula: C6H2BrClF2O2S
Molecular Weight: 291.5
MDL number: MFCD00042181
| Pack Size | Price | Stock | Quantity |
| 1g | RMB124.00 | In Stock |
|
| 5g | RMB478.40 | In Stock |
|
| 25g | RMB1653.60 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 38-42 °C (lit.) |
| Boiling point: | 76°C 0,01mm |
| Density | 1.934±0.06 g/cm3 (20 ºC 760 Torr) |
| Flash point: | >230 °F |
| storage temp. | Inert atmosphere,Room Temperature |
| solubility | soluble in Acetone |
| form | Crystalline Powder or Crystals |
| color | White to yellow or orange, may darken on storage |
| Sensitive | Moisture Sensitive |
| InChI | 1S/C6H2BrClF2O2S/c7-3-1-5(10)6(2-4(3)9)13(8,11)12/h1-2H |
| InChIKey | SBMKFWMFNIEPDN-UHFFFAOYSA-N |
| SMILES | Fc1cc(c(F)cc1Br)S(Cl)(=O)=O |
| CAS DataBase Reference | 207974-14-9(CAS DataBase Reference) |
Safety
| Symbol(GHS) |  GHS05 |
| Signal word | Danger |
| Hazard statements | H314 |
| Precautionary statements | P260-P280-P303+P361+P353-P304+P340+P310-P305+P351+P338-P363 |
| PPE | Eyeshields, Faceshields, Gloves, type P3 (EN 143) respirator cartridges |
| Hazard Codes | C |
| Risk Statements | 34 |
| Safety Statements | 26-36/37/39-45 |
| RIDADR | UN 3261 8/PG 3 |
| WGK Germany | 3 |
| Hazard Note | Corrosive/Moisture Sensitive |
| HazardClass | 8 |
| PackingGroup | II |
| HS Code | 29049090 |
| Storage Class | 8A - Combustible corrosive hazardous materials |
| Hazard Classifications | Eye Dam. 1 Skin Corr. 1B |
| Limited Quantities | 5.0 L (1.3 gallons) (liquid) or 5.0 kg (11 lbs) (solid) |
| Excepted Quantities | Max Inner Pack (30g or 30ml) and Max Outer Pack (1Kg or 1L) |
