BD8414631
1-Boc-4-Fluoro-4-(hydroxymethyl)piperidine , 95% , 614730-97-1
| Pack Size | Price | Stock | Quantity |
| 250mg | RMB96.00 | In Stock |
|
| 1g | RMB239.20 | In Stock |
|
| 5g | RMB815.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Boiling point: | 311.0±27.0 °C(Predicted) |
| Density | 1.13±0.1 g/cm3(Predicted) |
| storage temp. | 2-8°C |
| pka | 14.94±0.10(Predicted) |
| Appearance | Colorless to off-white Solid-Liquid Mixture |
| InChI | InChI=1S/C11H20FNO3/c1-10(2,3)16-9(15)13-6-4-11(12,8-14)5-7-13/h14H,4-8H2,1-3H3 |
| InChIKey | BWZOULIMVKCGII-UHFFFAOYSA-N |
| SMILES | N1(C(OC(C)(C)C)=O)CCC(F)(CO)CC1 |
Description and Uses
tert-Butyl 4-Fluoro-4-(hydroxymethyl)piperidine-1-carboxylate is used in preparation of heterocyclic compounds as BCL 2 inhibitors.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H302-H315-H319-H332-H335 |
| Precautionary statements | P261-P280-P305+P351+P338 |
| HS Code | 2933399990 |



![tert-Butyl 6-oxo-2-azaspiro[3.3]heptane-2-carboxylate](https://img.chemicalbook.com/CAS/20180808/GIF/1181816-12-5.gif)

![tert-butyl 2,7-diazaspiro[3.5]nonane-2-carboxylate](https://img.chemicalbook.com/CAS/GIF/236406-55-6.gif)

