BD8423631
Isochroman-1-one , 95% , 4702-34-5
CAS NO.：4702-34-5
Empirical Formula: C9H8O2
Molecular Weight: 148.16
MDL number: MFCD00799232
EINECS: 225-179-4
| Pack Size | Price | Stock | Quantity |
| 250mg | RMB28.00 | In Stock |
|
| 1g | RMB78.40 | In Stock |
|
| 5g | RMB310.40 | In Stock |
|
| 10g | RMB580.80 | In Stock |
|
| 25g | RMB1032.00 | In Stock |
|
| 100g | RMB3778.40 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 37-39 °C |
| Boiling point: | 160°C/11mmHg(lit.) |
| Density | 1.2030 |
| refractive index | 1.5640 to 1.5680 |
| storage temp. | Sealed in dry,Room Temperature |
| form | clear liquid |
| color | Colorless to Light orange to Yellow |
| InChI | InChI=1S/C9H8O2/c10-9-8-4-2-1-3-7(8)5-6-11-9/h1-4H,5-6H2 |
| InChIKey | XVTAQSGZOGYIEY-UHFFFAOYSA-N |
| SMILES | C1OC(=O)C2=CC=CC=C2C1 |
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P264-P271-P280-P302+P352-P304+P340+P312-P305+P351+P338-P332+P313-P337+P313-P362-P403+P233-P405-P501 |
| HS Code | 2932990090 |
